C13H9F4N — CID 141400644
2,3,5,6-tetrafluoro-4-(1-phenylethyl)pyridine (PubChem CID 141400644) has the molecular formula C13H9F4N and a molecular weight of 255.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(1-phenylethyl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(1-phenylethyl)pyridine |
|---|---|
| PubChem CID | 141400644 |
| Molecular Formula | C13H9F4N |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(1-phenylethyl)pyridine |
| SMILES | CC(c1ccccc1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H9F4N/c1-7(8-5-3-2-4-6-8)9-10(14)12(16)18-13(17)11(9)15/h2-7H,1H3 |
| InChIKey | QFEWRJWWRCEFEL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|