C12H14N2O3 — CID 102201149
ethyl 2-oxo-4-phenylimidazolidine-4-carboxylate (PubChem CID 102201149) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is ethyl 2-oxo-4-phenylimidazolidine-4-carboxylate.
| Compound Name | ethyl 2-oxo-4-phenylimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 102201149 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | ethyl 2-oxo-4-phenylimidazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CNC(=O)N1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-17-10(15)12(8-13-11(16)14-12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,14,16) |
| InChIKey | XVHQNLLVQVJPGI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |