C17H12N2OS — CID 102203141
11-methyl-8-phenyl-3-thia-9,10-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene-12-carbaldehyde (PubChem CID 102203141) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 11-methyl-8-phenyl-3-thia-9,10-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene-12-carbaldehyde.
| Compound Name | 11-methyl-8-phenyl-3-thia-9,10-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene-12-carbaldehyde |
|---|---|
| PubChem CID | 102203141 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 11-methyl-8-phenyl-3-thia-9,10-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene-12-carbaldehyde |
| SMILES | Cc1nn2c(-c3ccccc3)cc3ccsc3c2c1C=O |
| InChI | InChI=1S/C17H12N2OS/c1-11-14(10-20)16-17-13(7-8-21-17)9-15(19(16)18-11)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | WMIHEOUIJQMUKE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|