C10H21O2P — CID 102203785
1-butoxy-3,4-dimethyl-1λ5-phospholane 1-oxide (PubChem CID 102203785) has the molecular formula C10H21O2P and a molecular weight of 204.25 g/mol. Its IUPAC name is 1-butoxy-3,4-dimethyl-1λ5-phospholane 1-oxide.
| Compound Name | 1-butoxy-3,4-dimethyl-1λ5-phospholane 1-oxide |
|---|---|
| PubChem CID | 102203785 |
| Molecular Formula | C10H21O2P |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-butoxy-3,4-dimethyl-1λ5-phospholane 1-oxide |
| SMILES | CCCCOP1(=O)CC(C)C(C)C1 |
| InChI | InChI=1S/C10H21O2P/c1-4-5-6-12-13(11)7-9(2)10(3)8-13/h9-10H,4-8H2,1-3H3 |
| InChIKey | OPPOCLDVEPYXEO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|