C46H40N2P2+2 — CID 102212130
[5-[5-(azaniumylmethyl)-2-diphenylphosphanylnaphthalen-1-yl]-6-diphenylphosphanylnaphthalen-1-yl]methylazanium (PubChem CID 102212130) has the molecular formula C46H40N2P2+2 and a molecular weight of 682.79 g/mol. Its IUPAC name is [5-[5-(azaniumylmethyl)-2-diphenylphosphanylnaphthalen-1-yl]-6-diphenylphosphanylnaphthalen-1-yl]methylazanium.
| Compound Name | [5-[5-(azaniumylmethyl)-2-diphenylphosphanylnaphthalen-1-yl]-6-diphenylphosphanylnaphthalen-1-yl]methylazanium |
|---|---|
| PubChem CID | 102212130 |
| Molecular Formula | C46H40N2P2+2 |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.27 |
| IUPAC Name | [5-[5-(azaniumylmethyl)-2-diphenylphosphanylnaphthalen-1-yl]-6-diphenylphosphanylnaphthalen-1-yl]methylazanium |
| SMILES | [NH3+]Cc1cccc2c(-c3c(P(c4ccccc4)c4ccccc4)ccc4c(C[NH3+])cccc34)c(P(c3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C46H38N2P2/c47-31-33-15-13-25-41-39(33)27-29-43(49(35-17-5-1-6-18-35)36-19-7-2-8-20-36)45(41)46-42-26-14-16-34(32-48)40(42)28-30-44(46)50(37-21-9-3-10-22-37)38-23-11-4-12-24-38/h1-30H,31-32,47-48H2/p+2 |
| InChIKey | QIVZPOZPYQDABG-UHFFFAOYSA-P |
| XLogP | 6.66 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|