C47H35BrN2P2 — CID 139247545
[1-(2-diphenylphosphanyl-5-imidazol-3-ium-1-ylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane bromide (PubChem CID 139247545) has the molecular formula C47H35BrN2P2 and a molecular weight of 769.66 g/mol. Its IUPAC name is [1-(2-diphenylphosphanyl-5-imidazol-3-ium-1-ylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane bromide.
| Compound Name | [1-(2-diphenylphosphanyl-5-imidazol-3-ium-1-ylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane bromide |
|---|---|
| PubChem CID | 139247545 |
| Molecular Formula | C47H35BrN2P2 |
| Molecular Weight | 769.66 g/mol |
| Exact Mass | 768.15 |
| IUPAC Name | [1-(2-diphenylphosphanyl-5-imidazol-3-ium-1-ylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane bromide |
| SMILES | [Br-].c1ccc(P(c2ccccc2)c2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3c(-n4cc[nH+]c4)cccc23)cc1 |
| InChI | InChI=1S/C47H34N2P2.BrH/c1-5-17-36(18-6-1)50(37-19-7-2-8-20-37)44-30-28-35-16-13-14-25-40(35)46(44)47-42-26-15-27-43(49-33-32-48-34-49)41(42)29-31-45(47)51(38-21-9-3-10-22-38)39-23-11-4-12-24-39;/h1-34H;1H |
| InChIKey | RQIIIUBEEMKAEW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 19.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|