C16H16O8 — CID 102213492
methyl 2-[2,3-dihydroxy-4-(1-hydroxy-2-methoxy-2-oxoethyl)naphthalen-1-yl]-2-hydroxyacetate (PubChem CID 102213492) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is methyl 2-[2,3-dihydroxy-4-(1-hydroxy-2-methoxy-2-oxoethyl)naphthalen-1-yl]-2-hydroxyacetate.
| Compound Name | methyl 2-[2,3-dihydroxy-4-(1-hydroxy-2-methoxy-2-oxoethyl)naphthalen-1-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 102213492 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl 2-[2,3-dihydroxy-4-(1-hydroxy-2-methoxy-2-oxoethyl)naphthalen-1-yl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1c(O)c(O)c(C(O)C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C16H16O8/c1-23-15(21)13(19)9-7-5-3-4-6-8(7)10(12(18)11(9)17)14(20)16(22)24-2/h3-6,13-14,17-20H,1-2H3 |
| InChIKey | OWNJZHVVRYPLHE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|