C21H37FSi — CID 102215052
fluoro-di(propan-2-yl)-[2,4,6-tri(propan-2-yl)phenyl]silane (PubChem CID 102215052) has the molecular formula C21H37FSi and a molecular weight of 336.61 g/mol. Its IUPAC name is fluoro-di(propan-2-yl)-[2,4,6-tri(propan-2-yl)phenyl]silane.
| Compound Name | fluoro-di(propan-2-yl)-[2,4,6-tri(propan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 102215052 |
| Molecular Formula | C21H37FSi |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | fluoro-di(propan-2-yl)-[2,4,6-tri(propan-2-yl)phenyl]silane |
| SMILES | CC(C)c1cc(C(C)C)c([Si](F)(C(C)C)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C21H37FSi/c1-13(2)18-11-19(14(3)4)21(20(12-18)15(5)6)23(22,16(7)8)17(9)10/h11-17H,1-10H3 |
| InChIKey | YRYNTVLXVIZGHC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|