C16H22O4 — CID 102215611
dimethyl (1R,4S,5R)-5-methyl-3-propan-2-ylidene-5-[(E)-prop-1-enyl]bicyclo[2.1.0]pentane-2,2-dicarboxylate (PubChem CID 102215611) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is dimethyl (1R,4S,5R)-5-methyl-3-propan-2-ylidene-5-[(E)-prop-1-enyl]bicyclo[2.1.0]pentane-2,2-dicarboxylate.
| Compound Name | dimethyl (1R,4S,5R)-5-methyl-3-propan-2-ylidene-5-[(E)-prop-1-enyl]bicyclo[2.1.0]pentane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102215611 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | dimethyl (1R,4S,5R)-5-methyl-3-propan-2-ylidene-5-[(E)-prop-1-enyl]bicyclo[2.1.0]pentane-2,2-dicarboxylate |
| SMILES | C/C=C/[C@]1(C)[C@H]2C(=C(C)C)C(C(=O)OC)(C(=O)OC)[C@H]21 |
| InChI | InChI=1S/C16H22O4/c1-7-8-15(4)11-10(9(2)3)16(12(11)15,13(17)19-5)14(18)20-6/h7-8,11-12H,1-6H3/b8-7+/t11-,12+,15+/m0/s1 |
| InChIKey | NONVWLVTYTUQCV-LZQVSFONSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|