C17H24NO+ — CID 102218856
3-heptyl-2-methyl-5-phenyl-1,2-oxazol-2-ium (PubChem CID 102218856) has the molecular formula C17H24NO+ and a molecular weight of 258.38 g/mol. Its IUPAC name is 3-heptyl-2-methyl-5-phenyl-1,2-oxazol-2-ium.
| Compound Name | 3-heptyl-2-methyl-5-phenyl-1,2-oxazol-2-ium |
|---|---|
| PubChem CID | 102218856 |
| Molecular Formula | C17H24NO+ |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-heptyl-2-methyl-5-phenyl-1,2-oxazol-2-ium |
| SMILES | CCCCCCCc1cc(-c2ccccc2)o[n+]1C |
| InChI | InChI=1S/C17H24NO/c1-3-4-5-6-10-13-16-14-17(19-18(16)2)15-11-8-7-9-12-15/h7-9,11-12,14H,3-6,10,13H2,1-2H3/q+1 |
| InChIKey | ICDYIXZFFBHSOK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|