About ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate
ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate (PubChem CID 102218988) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate |
| PubChem CID | 102218988 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate |
| SMILES | CCCCC1=C(C(=O)C(=O)OCC)C2C=CC1CC2 |
| InChI | InChI=1S/C16H22O3/c1-3-5-6-13-11-7-9-12(10-8-11)14(13)15(17)16(18)19-4-2/h7,9,11-12H,3-6,8,10H2,1-2H3 |
| InChIKey | YUDAYRVRPQTORG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate?
The IUPAC name of ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate (CID 102218988) is ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate.
What is the SMILES notation for ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate?
The canonical SMILES for ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate is CCCCC1=C(C(=O)C(=O)OCC)C2C=CC1CC2.
What is the InChIKey of ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate?
The InChIKey is YUDAYRVRPQTORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-3-5-6-13-11-7-9-12(10-8-11)14(13)15(17)16(18)19-4-2/h7,9,11-12H,3-6,8,10H2,1-2H3.
What are the key properties of ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate?
ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate has a molecular weight of 262.35 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-butyl-2-bicyclo[2.2.2]octa-2,5-dienyl)-2-oxoacetate is sourced from PubChem (CID 102218988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).