C13H16O5 — CID 117383449
ethyl 2-(3,6-dimethoxy-2-methylphenyl)-2-oxoacetate (PubChem CID 117383449) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 2-(3,6-dimethoxy-2-methylphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(3,6-dimethoxy-2-methylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117383449 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | ethyl 2-(3,6-dimethoxy-2-methylphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(OC)ccc(OC)c1C |
| InChI | InChI=1S/C13H16O5/c1-5-18-13(15)12(14)11-8(2)9(16-3)6-7-10(11)17-4/h6-7H,5H2,1-4H3 |
| InChIKey | OUYBRACDCAFWNG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|