C13H17NO3S — CID 102219565
N-(5-hydroxypent-1-ynyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 102219565) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(5-hydroxypent-1-ynyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(5-hydroxypent-1-ynyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 102219565 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-(5-hydroxypent-1-ynyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C#CCCCO)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-12-6-8-13(9-7-12)18(16,17)14(2)10-4-3-5-11-15/h6-9,15H,3,5,11H2,1-2H3 |
| InChIKey | LDEKFQYOEMXLMD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|