C15H16O5 — CID 102219776
methyl (2E,4E)-6-(2-formyl-6-methoxyphenoxy)hexa-2,4-dienoate (PubChem CID 102219776) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (2E,4E)-6-(2-formyl-6-methoxyphenoxy)hexa-2,4-dienoate.
| Compound Name | methyl (2E,4E)-6-(2-formyl-6-methoxyphenoxy)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 102219776 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl (2E,4E)-6-(2-formyl-6-methoxyphenoxy)hexa-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/COc1c(C=O)cccc1OC |
| InChI | InChI=1S/C15H16O5/c1-18-13-8-6-7-12(11-16)15(13)20-10-5-3-4-9-14(17)19-2/h3-9,11H,10H2,1-2H3/b5-3+,9-4+ |
| InChIKey | OOMKOHGUAWFKMR-BMVOEDMYSA-N |
| XLogP | 2.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|