C38H56N2O2 — CID 102220061
2,9-bis(2-butyloctyl)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione (PubChem CID 102220061) has the molecular formula C38H56N2O2 and a molecular weight of 572.88 g/mol. Its IUPAC name is 2,9-bis(2-butyloctyl)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione.
| Compound Name | 2,9-bis(2-butyloctyl)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione |
|---|---|
| PubChem CID | 102220061 |
| Molecular Formula | C38H56N2O2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | 2,9-bis(2-butyloctyl)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione |
| SMILES | CCCCCCC(CCCC)Cn1c(=O)c2cccc3c2c2c(cccc21)c(=O)n3CC(CCCC)CCCCCC |
| InChI | InChI=1S/C38H56N2O2/c1-5-9-13-15-21-29(19-11-7-3)27-39-33-25-17-24-32-35(33)36-31(37(39)41)23-18-26-34(36)40(38(32)42)28-30(20-12-8-4)22-16-14-10-6-2/h17-18,23-26,29-30H,5-16,19-22,27-28H2,1-4H3 |
| InChIKey | RORWTUVTPCUGHA-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|