C19H23ClN4O3 — CID 10222019
8-(2-chloropyridine-3-carbonyl)-N-cyclopentyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide (PubChem CID 10222019) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 8-(2-chloropyridine-3-carbonyl)-N-cyclopentyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide.
| Compound Name | 8-(2-chloropyridine-3-carbonyl)-N-cyclopentyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
|---|---|
| PubChem CID | 10222019 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 8-(2-chloropyridine-3-carbonyl)-N-cyclopentyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
| SMILES | O=C(NC1CCCC1)C1=NOC2(CCN(C(=O)c3cccnc3Cl)CC2)C1 |
| InChI | InChI=1S/C19H23ClN4O3/c20-16-14(6-3-9-21-16)18(26)24-10-7-19(8-11-24)12-15(23-27-19)17(25)22-13-4-1-2-5-13/h3,6,9,13H,1-2,4-5,7-8,10-12H2,(H,22,25) |
| InChIKey | QROJVJHKBLNTFG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|