C24H19NO — CID 102223207
1-(2,3,5-triphenylpyrrol-1-yl)ethanone (PubChem CID 102223207) has the molecular formula C24H19NO and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(2,3,5-triphenylpyrrol-1-yl)ethanone.
| Compound Name | 1-(2,3,5-triphenylpyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 102223207 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(2,3,5-triphenylpyrrol-1-yl)ethanone |
| SMILES | CC(=O)n1c(-c2ccccc2)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H19NO/c1-18(26)25-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)24(25)21-15-9-4-10-16-21/h2-17H,1H3 |
| InChIKey | CRMGEKUYVAEECU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |