C24H17Br2NO — CID 102223215
1-[2,3-bis(4-bromophenyl)-5-phenylpyrrol-1-yl]ethanone (PubChem CID 102223215) has the molecular formula C24H17Br2NO and a molecular weight of 495.21 g/mol. Its IUPAC name is 1-[2,3-bis(4-bromophenyl)-5-phenylpyrrol-1-yl]ethanone.
| Compound Name | 1-[2,3-bis(4-bromophenyl)-5-phenylpyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 102223215 |
| Molecular Formula | C24H17Br2NO |
| Molecular Weight | 495.21 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | 1-[2,3-bis(4-bromophenyl)-5-phenylpyrrol-1-yl]ethanone |
| SMILES | CC(=O)n1c(-c2ccccc2)cc(-c2ccc(Br)cc2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H17Br2NO/c1-16(28)27-23(18-5-3-2-4-6-18)15-22(17-7-11-20(25)12-8-17)24(27)19-9-13-21(26)14-10-19/h2-15H,1H3 |
| InChIKey | OOJCBDPMFQFUBY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.21 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |