C28H36F3NO6Si — CID 102223976
N-[(4aR,6S,7R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide (PubChem CID 102223976) has the molecular formula C28H36F3NO6Si and a molecular weight of 567.68 g/mol. Its IUPAC name is N-[(4aR,6S,7R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4aR,6S,7R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 102223976 |
| Molecular Formula | C28H36F3NO6Si |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | N-[(4aR,6S,7R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H36F3NO6Si/c1-27(2,3)39(4,5)38-25-21(32-26(33)28(29,30)31)23(34-16-18-12-8-6-9-13-18)22-20(36-25)17-35-24(37-22)19-14-10-7-11-15-19/h6-15,20-25H,16-17H2,1-5H3,(H,32,33)/t20-,21-,22-,23-,24?,25+/m1/s1 |
| InChIKey | MOLPWKBSOXUJJL-WYXLOIEBSA-N |
| XLogP | 5.48 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|