C24H32N4O2S4 — CID 102225669
N-[4-[[4-acetamido-2,6-bis(ethylsulfanyl)phenyl]diazenyl]-3,5-bis(ethylsulfanyl)phenyl]acetamide (PubChem CID 102225669) has the molecular formula C24H32N4O2S4 and a molecular weight of 536.81 g/mol. Its IUPAC name is N-[4-[[4-acetamido-2,6-bis(ethylsulfanyl)phenyl]diazenyl]-3,5-bis(ethylsulfanyl)phenyl]acetamide.
| Compound Name | N-[4-[[4-acetamido-2,6-bis(ethylsulfanyl)phenyl]diazenyl]-3,5-bis(ethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 102225669 |
| Molecular Formula | C24H32N4O2S4 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[4-[[4-acetamido-2,6-bis(ethylsulfanyl)phenyl]diazenyl]-3,5-bis(ethylsulfanyl)phenyl]acetamide |
| SMILES | CCSc1cc(NC(C)=O)cc(SCC)c1/N=N/c1c(SCC)cc(NC(C)=O)cc1SCC |
| InChI | InChI=1S/C24H32N4O2S4/c1-7-31-19-11-17(25-15(5)29)12-20(32-8-2)23(19)27-28-24-21(33-9-3)13-18(26-16(6)30)14-22(24)34-10-4/h11-14H,7-10H2,1-6H3,(H,25,29)(H,26,30)/b28-27+ |
| InChIKey | WSDDLZJTSWVYQW-BYYHNAKLSA-N |
| XLogP | 8.47 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|