C16H12F4N4O2 — CID 102314121
N-[4-[(4-acetamido-2,6-difluorophenyl)diazenyl]-3,5-difluorophenyl]acetamide (PubChem CID 102314121) has the molecular formula C16H12F4N4O2 and a molecular weight of 368.29 g/mol. Its IUPAC name is N-[4-[(4-acetamido-2,6-difluorophenyl)diazenyl]-3,5-difluorophenyl]acetamide.
| Compound Name | N-[4-[(4-acetamido-2,6-difluorophenyl)diazenyl]-3,5-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 102314121 |
| Molecular Formula | C16H12F4N4O2 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[4-[(4-acetamido-2,6-difluorophenyl)diazenyl]-3,5-difluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(/N=N/c2c(F)cc(NC(C)=O)cc2F)c(F)c1 |
| InChI | InChI=1S/C16H12F4N4O2/c1-7(25)21-9-3-11(17)15(12(18)4-9)23-24-16-13(19)5-10(6-14(16)20)22-8(2)26/h3-6H,1-2H3,(H,21,25)(H,22,26)/b24-23+ |
| InChIKey | RMHFBOOWJOCICA-WCWDXBQESA-N |
| XLogP | 4.58 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|