C13H25N5O — CID 102227110
(1S,2R)-1-azido-1-cyclohexyl-3-morpholin-4-ylpropan-2-amine (PubChem CID 102227110) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is (1S,2R)-1-azido-1-cyclohexyl-3-morpholin-4-ylpropan-2-amine.
| Compound Name | (1S,2R)-1-azido-1-cyclohexyl-3-morpholin-4-ylpropan-2-amine |
|---|---|
| PubChem CID | 102227110 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | (1S,2R)-1-azido-1-cyclohexyl-3-morpholin-4-ylpropan-2-amine |
| SMILES | [N-]=[N+]=N[C@@H](C1CCCCC1)[C@H](N)CN1CCOCC1 |
| InChI | InChI=1S/C13H25N5O/c14-12(10-18-6-8-19-9-7-18)13(16-17-15)11-4-2-1-3-5-11/h11-13H,1-10,14H2/t12-,13+/m1/s1 |
| InChIKey | ZLGTYPQUBCVACW-OLZOCXBDSA-N |
| XLogP | 1.91 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|