C8H12N2O2 — CID 102227163
N-[(1S)-1-(4-methyl-1,3-oxazol-2-yl)ethyl]acetamide (PubChem CID 102227163) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is N-[(1S)-1-(4-methyl-1,3-oxazol-2-yl)ethyl]acetamide.
| Compound Name | N-[(1S)-1-(4-methyl-1,3-oxazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 102227163 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-[(1S)-1-(4-methyl-1,3-oxazol-2-yl)ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1nc(C)co1 |
| InChI | InChI=1S/C8H12N2O2/c1-5-4-12-8(9-5)6(2)10-7(3)11/h4,6H,1-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | MKKVLPYQKGYHOW-LURJTMIESA-N |
| XLogP | 1.18 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |