C7H12N2O2 — CID 82416174
3-amino-1-(4-methyl-1,3-oxazol-2-yl)propan-1-ol (PubChem CID 82416174) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 3-amino-1-(4-methyl-1,3-oxazol-2-yl)propan-1-ol.
| Compound Name | 3-amino-1-(4-methyl-1,3-oxazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 82416174 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-amino-1-(4-methyl-1,3-oxazol-2-yl)propan-1-ol |
| SMILES | Cc1coc(C(O)CCN)n1 |
| InChI | InChI=1S/C7H12N2O2/c1-5-4-11-7(9-5)6(10)2-3-8/h4,6,10H,2-3,8H2,1H3 |
| InChIKey | PXGVBQRNVKTGGO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |