C19H24N2O2 — CID 10222746
ethyl 4-[3-(dimethylamino)-1-pyridin-2-ylpropyl]benzoate (PubChem CID 10222746) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 4-[3-(dimethylamino)-1-pyridin-2-ylpropyl]benzoate.
| Compound Name | ethyl 4-[3-(dimethylamino)-1-pyridin-2-ylpropyl]benzoate |
|---|---|
| PubChem CID | 10222746 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl 4-[3-(dimethylamino)-1-pyridin-2-ylpropyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(CCN(C)C)c2ccccn2)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-4-23-19(22)16-10-8-15(9-11-16)17(12-14-21(2)3)18-7-5-6-13-20-18/h5-11,13,17H,4,12,14H2,1-3H3 |
| InChIKey | COZSQYSZECDRLO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |