C17H21ClN2 — CID 90681228
4-(4-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine (PubChem CID 90681228) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine.
| Compound Name | 4-(4-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 90681228 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine |
| SMILES | CN(C)CCCC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C17H21ClN2/c1-20(2)13-5-6-16(17-7-3-4-12-19-17)14-8-10-15(18)11-9-14/h3-4,7-12,16H,5-6,13H2,1-2H3 |
| InChIKey | HRRJJHUYGOZLPF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |