C20H28ClN3 — CID 57132350
1-N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]hexane-1,5-diamine (PubChem CID 57132350) has the molecular formula C20H28ClN3 and a molecular weight of 345.92 g/mol. Its IUPAC name is 1-N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]hexane-1,5-diamine.
| Compound Name | 1-N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]hexane-1,5-diamine |
|---|---|
| PubChem CID | 57132350 |
| Molecular Formula | C20H28ClN3 |
| Molecular Weight | 345.92 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]hexane-1,5-diamine |
| SMILES | CC(N)CCCCNCCC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C20H28ClN3/c1-16(22)6-2-4-13-23-15-12-19(20-7-3-5-14-24-20)17-8-10-18(21)11-9-17/h3,5,7-11,14,16,19,23H,2,4,6,12-13,15,22H2,1H3 |
| InChIKey | HCXJUAPJDPWBHS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|