C17H18N2 — CID 138977587
6-phenyl-6-pyridin-2-ylhexanenitrile (PubChem CID 138977587) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 6-phenyl-6-pyridin-2-ylhexanenitrile.
| Compound Name | 6-phenyl-6-pyridin-2-ylhexanenitrile |
|---|---|
| PubChem CID | 138977587 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 6-phenyl-6-pyridin-2-ylhexanenitrile |
| SMILES | N#CCCCCC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C17H18N2/c18-13-7-2-5-11-16(15-9-3-1-4-10-15)17-12-6-8-14-19-17/h1,3-4,6,8-10,12,14,16H,2,5,7,11H2 |
| InChIKey | MATREECHXQHUOS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|