C21H29N — CID 57295070
2-(4-ethyl-5,5-dimethyl-1-phenylhexyl)pyridine (PubChem CID 57295070) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-(4-ethyl-5,5-dimethyl-1-phenylhexyl)pyridine.
| Compound Name | 2-(4-ethyl-5,5-dimethyl-1-phenylhexyl)pyridine |
|---|---|
| PubChem CID | 57295070 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-(4-ethyl-5,5-dimethyl-1-phenylhexyl)pyridine |
| SMILES | CCC(CCC(c1ccccc1)c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C21H29N/c1-5-18(21(2,3)4)14-15-19(17-11-7-6-8-12-17)20-13-9-10-16-22-20/h6-13,16,18-19H,5,14-15H2,1-4H3 |
| InChIKey | ZJPBWMFWGOVEHG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |