C15H17BrN2 — CID 171379399
3-(4-bromophenyl)-3-pyridin-2-yl-N-(trideuteriomethyl)propan-1-amine (PubChem CID 171379399) has the molecular formula C15H17BrN2 and a molecular weight of 308.24 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-pyridin-2-yl-N-(trideuteriomethyl)propan-1-amine.
| Compound Name | 3-(4-bromophenyl)-3-pyridin-2-yl-N-(trideuteriomethyl)propan-1-amine |
|---|---|
| PubChem CID | 171379399 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-(4-bromophenyl)-3-pyridin-2-yl-N-(trideuteriomethyl)propan-1-amine |
| SMILES | [2H]C([2H])([2H])NCCC(c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C15H17BrN2/c1-17-11-9-14(15-4-2-3-10-18-15)12-5-7-13(16)8-6-12/h2-8,10,14,17H,9,11H2,1H3/i1D3 |
| InChIKey | LJCQBJWGCRNOHL-FIBGUPNXSA-N |
| XLogP | 3.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |