C23H30N2O4 — CID 102228821
2-[[(3aR,7aS)-3-[(2-hydroxy-5-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-methoxyphenol (PubChem CID 102228821) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[[(3aR,7aS)-3-[(2-hydroxy-5-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[(3aR,7aS)-3-[(2-hydroxy-5-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 102228821 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[[(3aR,7aS)-3-[(2-hydroxy-5-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CN2CN(Cc3cc(OC)ccc3O)[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-28-18-7-9-22(26)16(11-18)13-24-15-25(21-6-4-3-5-20(21)24)14-17-12-19(29-2)8-10-23(17)27/h7-12,20-21,26-27H,3-6,13-15H2,1-2H3/t20-,21+ |
| InChIKey | RLTRKISDYKAIOT-OYRHEFFESA-N |
| XLogP | 3.70 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|