C50H44F2N8O2 — CID 102229531
1,3-bis[(Z)-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(1H-indol-5-yl)but-2-enyl]pyrimidine-2,4-dione (PubChem CID 102229531) has the molecular formula C50H44F2N8O2 and a molecular weight of 826.95 g/mol. Its IUPAC name is 1,3-bis[(Z)-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(1H-indol-5-yl)but-2-enyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-bis[(Z)-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(1H-indol-5-yl)but-2-enyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102229531 |
| Molecular Formula | C50H44F2N8O2 |
| Molecular Weight | 826.95 g/mol |
| Exact Mass | 826.36 |
| IUPAC Name | 1,3-bis[(Z)-4-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(1H-indol-5-yl)but-2-enyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C/C=C(\CN2CCc3[nH]c4ccc(F)cc4c3C2)c2ccc3[nH]ccc3c2)c(=O)n1C/C=C(\CN1CCc2[nH]c3ccc(F)cc3c2C1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C50H44F2N8O2/c51-37-3-7-45-39(25-37)41-29-57(18-13-47(41)55-45)27-35(31-1-5-43-33(23-31)9-16-53-43)11-20-59-21-15-49(61)60(50(59)62)22-12-36(32-2-6-44-34(24-32)10-17-54-44)28-58-19-14-48-42(30-58)40-26-38(52)4-8-46(40)56-48/h1-12,15-17,21,23-26,53-56H,13-14,18-20,22,27-30H2/b35-11+,36-12+ |
| InChIKey | UPHXRPASUFXPBV-KSFZRBHCSA-N |
| XLogP | 8.50 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.95 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|