C24H22O3 — CID 102230796
(1R,5S,6R,12R)-6-phenyl-9,19-dioxapentacyclo[10.8.0.01,5.07,11.013,18]icosa-7(11),13,15,17-tetraen-20-one (PubChem CID 102230796) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (1R,5S,6R,12R)-6-phenyl-9,19-dioxapentacyclo[10.8.0.01,5.07,11.013,18]icosa-7(11),13,15,17-tetraen-20-one.
| Compound Name | (1R,5S,6R,12R)-6-phenyl-9,19-dioxapentacyclo[10.8.0.01,5.07,11.013,18]icosa-7(11),13,15,17-tetraen-20-one |
|---|---|
| PubChem CID | 102230796 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (1R,5S,6R,12R)-6-phenyl-9,19-dioxapentacyclo[10.8.0.01,5.07,11.013,18]icosa-7(11),13,15,17-tetraen-20-one |
| SMILES | O=C1Oc2ccccc2[C@H]2C3=C(COC3)[C@@H](c3ccccc3)[C@@H]3CCC[C@]123 |
| InChI | InChI=1S/C24H22O3/c25-23-24-12-6-10-19(24)21(15-7-2-1-3-8-15)17-13-26-14-18(17)22(24)16-9-4-5-11-20(16)27-23/h1-5,7-9,11,19,21-22H,6,10,12-14H2/t19-,21+,22-,24+/m0/s1 |
| InChIKey | CFCDZPDFMPMJPS-AYEXWZOKSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|