C25H26O9 — CID 102232162
ethyl 2-(3-acetyloxy-4-hydroxyphenyl)-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate (PubChem CID 102232162) has the molecular formula C25H26O9 and a molecular weight of 470.47 g/mol. Its IUPAC name is ethyl 2-(3-acetyloxy-4-hydroxyphenyl)-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-(3-acetyloxy-4-hydroxyphenyl)-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 102232162 |
| Molecular Formula | C25H26O9 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | ethyl 2-(3-acetyloxy-4-hydroxyphenyl)-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)/C=C/c1cc(OC)c2c(c1)C(C(=O)OCC)C(c1ccc(O)c(OC(C)=O)c1)O2 |
| InChI | InChI=1S/C25H26O9/c1-5-31-21(28)10-7-15-11-17-22(25(29)32-6-2)23(34-24(17)20(12-15)30-4)16-8-9-18(27)19(13-16)33-14(3)26/h7-13,22-23,27H,5-6H2,1-4H3/b10-7+ |
| InChIKey | ZYTDSVKSUBVFML-JXMROGBWSA-N |
| XLogP | 3.68 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|