C20H16O8-2 — CID 146036920
5-[(E)-2-carboxylatoethenyl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate (PubChem CID 146036920) has the molecular formula C20H16O8-2 and a molecular weight of 384.34 g/mol. Its IUPAC name is 5-[(E)-2-carboxylatoethenyl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate.
| Compound Name | 5-[(E)-2-carboxylatoethenyl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 146036920 |
| Molecular Formula | C20H16O8-2 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-[(E)-2-carboxylatoethenyl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxylate |
| SMILES | COc1cc(C2Oc3c(OC)cc(/C=C/C(=O)[O-])cc3C2C(=O)[O-])ccc1O |
| InChI | InChI=1S/C20H18O8/c1-26-14-9-11(4-5-13(14)21)18-17(20(24)25)12-7-10(3-6-16(22)23)8-15(27-2)19(12)28-18/h3-9,17-18,21H,1-2H3,(H,22,23)(H,24,25)/p-2/b6-3+ |
| InChIKey | JTHPLBUVRLOJBB-ZZXKWVIFSA-L |
| XLogP | 0.14 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|