About (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one
(4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one (PubChem CID 102233116) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one |
| PubChem CID | 102233116 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one |
| SMILES | Cc1ccc([C@H]2ON(C)C(=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C11H13NO3/c1-7-3-5-8(6-4-7)10-9(13)11(14)12(2)15-10/h3-6,9-10,13H,1-2H3/t9-,10-/m1/s1 |
| InChIKey | AYHFMVWHFABRLI-NXEZZACHSA-N |
| XLogP | 0.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one?
The IUPAC name of (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one (CID 102233116) is (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one.
What is the SMILES notation for (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one?
The canonical SMILES for (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one is Cc1ccc([C@H]2ON(C)C(=O)[C@@H]2O)cc1.
What is the InChIKey of (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one?
The InChIKey is AYHFMVWHFABRLI-NXEZZACHSA-N. The full InChI is InChI=1S/C11H13NO3/c1-7-3-5-8(6-4-7)10-9(13)11(14)12(2)15-10/h3-6,9-10,13H,1-2H3/t9-,10-/m1/s1.
What are the key properties of (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one?
(4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one has a molecular weight of 207.23 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4-hydroxy-2-methyl-5-(4-methylphenyl)-1,2-oxazolidin-3-one is sourced from PubChem (CID 102233116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).