C26H26N2O6 — CID 102233295
(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)methyl 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 102233295) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)methyl 2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | (4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)methyl 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 102233295 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl)methyl 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)OCc1cc(=O)oc2c3c4c(cc12)CCCN4CCC3 |
| InChI | InChI=1S/C26H26N2O6/c29-22-13-19(16-32-23(30)14-27-26(31)33-15-17-6-2-1-3-7-17)21-12-18-8-4-10-28-11-5-9-20(24(18)28)25(21)34-22/h1-3,6-7,12-13H,4-5,8-11,14-16H2,(H,27,31) |
| InChIKey | RGQRLZIYWVVKSB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|