C30H26O16 — CID 102233532
[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-6-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 102233532) has the molecular formula C30H26O16 and a molecular weight of 642.52 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-6-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-6-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102233532 |
| Molecular Formula | C30H26O16 |
| Molecular Weight | 642.52 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-6-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC[C@H]1O[C@@H](Oc2c(O)cc3oc(-c4ccc(O)c(O)c4)c(O)c(=O)c3c2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O16/c31-13-4-1-11(7-15(13)33)2-6-20(36)43-10-19-22(37)25(40)27(42)30(45-19)46-29-17(35)9-18-21(24(29)39)23(38)26(41)28(44-18)12-3-5-14(32)16(34)8-12/h1-9,19,22,25,27,30-35,37,39-42H,10H2/b6-2+/t19-,22-,25+,27-,30+/m1/s1 |
| InChIKey | AFPKOGQHMWOULN-KLLLAIOQSA-N |
| XLogP | 0.84 |
| TPSA | 277.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.52 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|