C20H19NO5S — CID 102234862
diethyl 3-(5-acetylthiophen-2-yl)indolizine-1,2-dicarboxylate (PubChem CID 102234862) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is diethyl 3-(5-acetylthiophen-2-yl)indolizine-1,2-dicarboxylate.
| Compound Name | diethyl 3-(5-acetylthiophen-2-yl)indolizine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102234862 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | diethyl 3-(5-acetylthiophen-2-yl)indolizine-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2ccccn2c1-c1ccc(C(C)=O)s1 |
| InChI | InChI=1S/C20H19NO5S/c1-4-25-19(23)16-13-8-6-7-11-21(13)18(17(16)20(24)26-5-2)15-10-9-14(27-15)12(3)22/h6-11H,4-5H2,1-3H3 |
| InChIKey | ZGOUDKFJZFCVKB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |