C12H19IO2 — CID 102235083
tert-butyl (E)-7-iodo-4-methylidenehept-6-enoate (PubChem CID 102235083) has the molecular formula C12H19IO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is tert-butyl (E)-7-iodo-4-methylidenehept-6-enoate.
| Compound Name | tert-butyl (E)-7-iodo-4-methylidenehept-6-enoate |
|---|---|
| PubChem CID | 102235083 |
| Molecular Formula | C12H19IO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | tert-butyl (E)-7-iodo-4-methylidenehept-6-enoate |
| SMILES | C=C(C/C=C/I)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19IO2/c1-10(6-5-9-13)7-8-11(14)15-12(2,3)4/h5,9H,1,6-8H2,2-4H3/b9-5+ |
| InChIKey | HYQKEYNNDWISNS-WEVVVXLNSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|