C29H27NO4 — CID 102236750
5,23-dimethoxy-14-propyl-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,12(16),20(25),21,23-nonaene-13,15-dione (PubChem CID 102236750) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 5,23-dimethoxy-14-propyl-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,12(16),20(25),21,23-nonaene-13,15-dione.
| Compound Name | 5,23-dimethoxy-14-propyl-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,12(16),20(25),21,23-nonaene-13,15-dione |
|---|---|
| PubChem CID | 102236750 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 5,23-dimethoxy-14-propyl-14-azahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3(8),4,6,12(16),20(25),21,23-nonaene-13,15-dione |
| SMILES | CCCN1C(=O)c2c3c(c4c(c2C1=O)CCc1ccc(OC)cc1-4)-c1cc(OC)ccc1CC3 |
| InChI | InChI=1S/C29H27NO4/c1-4-13-30-28(31)26-20-11-7-16-5-9-18(33-2)14-22(16)24(20)25-21(27(26)29(30)32)12-8-17-6-10-19(34-3)15-23(17)25/h5-6,9-10,14-15H,4,7-8,11-13H2,1-3H3 |
| InChIKey | JPCMUCFZPYJNCZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|