C14H17N3O2 — CID 102237472
(1R,9S)-11-nitroso-5-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 102237472) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (1R,9S)-11-nitroso-5-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-nitroso-5-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 102237472 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (1R,9S)-11-nitroso-5-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | C=CCc1ccc2n(c1=O)C[C@@H]1C[C@@H]2CN(N=O)C1 |
| InChI | InChI=1S/C14H17N3O2/c1-2-3-11-4-5-13-12-6-10(7-16(9-12)15-19)8-17(13)14(11)18/h2,4-5,10,12H,1,3,6-9H2/t10-,12-/m1/s1 |
| InChIKey | ZHAUXMNIOADCPF-ZYHUDNBSSA-N |
| XLogP | 1.68 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|