C12H17N2O2P — CID 21363476
5-(hydroxymethyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 21363476) has the molecular formula C12H17N2O2P and a molecular weight of 252.25 g/mol. Its IUPAC name is 5-(hydroxymethyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 5-(hydroxymethyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 21363476 |
| Molecular Formula | C12H17N2O2P |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-(hydroxymethyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1c(CO)ccc2n1CC1CC2CN(P)C1 |
| InChI | InChI=1S/C12H17N2O2P/c15-7-9-1-2-11-10-3-8(4-13(17)6-10)5-14(11)12(9)16/h1-2,8,10,15H,3-7,17H2 |
| InChIKey | KLIPQMJEHQJDSG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|