C13H17N2O2P — CID 21363479
5-(1-hydroxyethenyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 21363479) has the molecular formula C13H17N2O2P and a molecular weight of 264.26 g/mol. Its IUPAC name is 5-(1-hydroxyethenyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 5-(1-hydroxyethenyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 21363479 |
| Molecular Formula | C13H17N2O2P |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-(1-hydroxyethenyl)-11-phosphanyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | C=C(O)c1ccc2n(c1=O)CC1CC2CN(P)C1 |
| InChI | InChI=1S/C13H17N2O2P/c1-8(16)11-2-3-12-10-4-9(5-14(18)7-10)6-15(12)13(11)17/h2-3,9-10,16H,1,4-7,18H2 |
| InChIKey | JTTKHYHPOOZTKJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|