C15H24OSi — CID 102237617
triethyl-[2-[2-(methoxymethyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane (PubChem CID 102237617) has the molecular formula C15H24OSi and a molecular weight of 248.44 g/mol. Its IUPAC name is triethyl-[2-[2-(methoxymethyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane.
| Compound Name | triethyl-[2-[2-(methoxymethyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 102237617 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | triethyl-[2-[2-(methoxymethyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane |
| SMILES | CC[Si](C#CC1=C(COC)C=CC1)(CC)CC |
| InChI | InChI=1S/C15H24OSi/c1-5-17(6-2,7-3)12-11-14-9-8-10-15(14)13-16-4/h8,10H,5-7,9,13H2,1-4H3 |
| InChIKey | RFBWUNGDJCQFGC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|