C12H20OSi — CID 11009158
[(E)-3-(4-ethenyl-2,5-dihydrofuran-3-yl)prop-2-enyl]-trimethylsilane (PubChem CID 11009158) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is [(E)-3-(4-ethenyl-2,5-dihydrofuran-3-yl)prop-2-enyl]-trimethylsilane.
| Compound Name | [(E)-3-(4-ethenyl-2,5-dihydrofuran-3-yl)prop-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11009158 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | [(E)-3-(4-ethenyl-2,5-dihydrofuran-3-yl)prop-2-enyl]-trimethylsilane |
| SMILES | C=CC1=C(/C=C/C[Si](C)(C)C)COC1 |
| InChI | InChI=1S/C12H20OSi/c1-5-11-9-13-10-12(11)7-6-8-14(2,3)4/h5-7H,1,8-10H2,2-4H3/b7-6+ |
| InChIKey | BCSBVUDKEZZLQT-VOTSOKGWSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|