C17H31NO3 — CID 102237783
(4S)-4-tert-butyl-3-[(3R)-3-methylnonanoyl]-1,3-oxazolidin-2-one (PubChem CID 102237783) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(3R)-3-methylnonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(3R)-3-methylnonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102237783 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(3R)-3-methylnonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@@H](C)CC(=O)N1C(=O)OC[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C17H31NO3/c1-6-7-8-9-10-13(2)11-15(19)18-14(17(3,4)5)12-21-16(18)20/h13-14H,6-12H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | NYCZZUCJQUUXHN-ZIAGYGMSSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|