C28H30N2O8S2 — CID 102238874
dimethyl 5-[(1R,3S,3aR,6aS)-3-methoxycarbonyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 102238874) has the molecular formula C28H30N2O8S2 and a molecular weight of 586.69 g/mol. Its IUPAC name is dimethyl 5-[(1R,3S,3aR,6aS)-3-methoxycarbonyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-[(1R,3S,3aR,6aS)-3-methoxycarbonyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102238874 |
| Molecular Formula | C28H30N2O8S2 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | dimethyl 5-[(1R,3S,3aR,6aS)-3-methoxycarbonyl-3-(2-methylsulfanylethyl)-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccc(N3C(=O)[C@H]4[C@@H](C3=O)[C@@](CCSC)(C(=O)OC)N[C@H]4c3cccs3)cc2C1 |
| InChI | InChI=1S/C28H30N2O8S2/c1-36-24(33)27(25(34)37-2)13-15-7-8-17(12-16(15)14-27)30-22(31)19-20(23(30)32)28(9-11-39-4,26(35)38-3)29-21(19)18-6-5-10-40-18/h5-8,10,12,19-21,29H,9,11,13-14H2,1-4H3/t19-,20-,21-,28-/m0/s1 |
| InChIKey | HIIVCHSYYNFMDG-MWBFYPDXSA-N |
| XLogP | 2.29 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|