C18H36O2Si — CID 102239079
[(E)-hex-1-enyl]-di(propan-2-yl)-[[(2S,3R)-3-propyloxiran-2-yl]methoxy]silane (PubChem CID 102239079) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is [(E)-hex-1-enyl]-di(propan-2-yl)-[[(2S,3R)-3-propyloxiran-2-yl]methoxy]silane.
| Compound Name | [(E)-hex-1-enyl]-di(propan-2-yl)-[[(2S,3R)-3-propyloxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 102239079 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | [(E)-hex-1-enyl]-di(propan-2-yl)-[[(2S,3R)-3-propyloxiran-2-yl]methoxy]silane |
| SMILES | CCCC/C=C/[Si](OC[C@@H]1O[C@@H]1CCC)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-7-9-10-11-13-21(15(3)4,16(5)6)19-14-18-17(20-18)12-8-2/h11,13,15-18H,7-10,12,14H2,1-6H3/b13-11+/t17-,18+/m1/s1 |
| InChIKey | KHQUHJHVURNMCZ-GFGUTWHHSA-N |
| XLogP | 5.62 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|