C29H64O4Si3 — CID 142657998
3-[(3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-1-en-4-yl]oxypropoxy-tert-butyl-dimethylsilane (PubChem CID 142657998) has the molecular formula C29H64O4Si3 and a molecular weight of 561.09 g/mol. Its IUPAC name is 3-[(3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-1-en-4-yl]oxypropoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-[(3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-1-en-4-yl]oxypropoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 142657998 |
| Molecular Formula | C29H64O4Si3 |
| Molecular Weight | 561.09 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | 3-[(3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-1-en-4-yl]oxypropoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCCCO[Si](C)(C)C(C)(C)C)[C@@H](CCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H64O4Si3/c1-18-21-25(33-36(16,17)29(9,10)11)26(24(19-2)32-35(14,15)28(6,7)8)30-22-20-23-31-34(12,13)27(3,4)5/h19,24-26H,2,18,20-23H2,1,3-17H3/t24-,25-,26-/m1/s1 |
| InChIKey | DBAHPFVFKTUEBD-TWJOJJKGSA-N |
| XLogP | 9.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.09 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|